C9H15N5O — CID 112732680
(4-methyl-1,4-diazepan-1-yl)-(2H-triazol-4-yl)methanone (PubChem CID 112732680) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is (4-methyl-1,4-diazepan-1-yl)-(2H-triazol-4-yl)methanone.
| Compound Name | (4-methyl-1,4-diazepan-1-yl)-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 112732680 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | (4-methyl-1,4-diazepan-1-yl)-(2H-triazol-4-yl)methanone |
| SMILES | CN1CCCN(C(=O)c2cn[nH]n2)CC1 |
| InChI | InChI=1S/C9H15N5O/c1-13-3-2-4-14(6-5-13)9(15)8-7-10-12-11-8/h7H,2-6H2,1H3,(H,10,11,12) |
| InChIKey | DBKMHEDZLXSBSQ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |