C11H18N4O — CID 79005614
(4,4-dimethylazepan-1-yl)-(2H-triazol-4-yl)methanone (PubChem CID 79005614) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is (4,4-dimethylazepan-1-yl)-(2H-triazol-4-yl)methanone.
| Compound Name | (4,4-dimethylazepan-1-yl)-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 79005614 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (4,4-dimethylazepan-1-yl)-(2H-triazol-4-yl)methanone |
| SMILES | CC1(C)CCCN(C(=O)c2cn[nH]n2)CC1 |
| InChI | InChI=1S/C11H18N4O/c1-11(2)4-3-6-15(7-5-11)10(16)9-8-12-14-13-9/h8H,3-7H2,1-2H3,(H,12,13,14) |
| InChIKey | ADWUPDZAPWQMRF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |