C9H13BrN4O — CID 131031529
[3-(bromomethyl)-3-methylpyrrolidin-1-yl]-(2H-triazol-4-yl)methanone (PubChem CID 131031529) has the molecular formula C9H13BrN4O and a molecular weight of 273.13 g/mol. Its IUPAC name is [3-(bromomethyl)-3-methylpyrrolidin-1-yl]-(2H-triazol-4-yl)methanone.
| Compound Name | [3-(bromomethyl)-3-methylpyrrolidin-1-yl]-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 131031529 |
| Molecular Formula | C9H13BrN4O |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | [3-(bromomethyl)-3-methylpyrrolidin-1-yl]-(2H-triazol-4-yl)methanone |
| SMILES | CC1(CBr)CCN(C(=O)c2cn[nH]n2)C1 |
| InChI | InChI=1S/C9H13BrN4O/c1-9(5-10)2-3-14(6-9)8(15)7-4-11-13-12-7/h4H,2-3,5-6H2,1H3,(H,11,12,13) |
| InChIKey | DITXVIHEKUINJF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|