C15H19N3O — CID 65281399
6-(4,4-dimethylazepane-1-carbonyl)pyridine-3-carbonitrile (PubChem CID 65281399) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 6-(4,4-dimethylazepane-1-carbonyl)pyridine-3-carbonitrile.
| Compound Name | 6-(4,4-dimethylazepane-1-carbonyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 65281399 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 6-(4,4-dimethylazepane-1-carbonyl)pyridine-3-carbonitrile |
| SMILES | CC1(C)CCCN(C(=O)c2ccc(C#N)cn2)CC1 |
| InChI | InChI=1S/C15H19N3O/c1-15(2)6-3-8-18(9-7-15)14(19)13-5-4-12(10-16)11-17-13/h4-5,11H,3,6-9H2,1-2H3 |
| InChIKey | QRRUIFMRABDISZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |