C14H17ClN4O — CID 63750103
6-[4-(2-chloroethyl)-1,4-diazepane-1-carbonyl]pyridine-3-carbonitrile (PubChem CID 63750103) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is 6-[4-(2-chloroethyl)-1,4-diazepane-1-carbonyl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-(2-chloroethyl)-1,4-diazepane-1-carbonyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 63750103 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 6-[4-(2-chloroethyl)-1,4-diazepane-1-carbonyl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(C(=O)N2CCCN(CCCl)CC2)nc1 |
| InChI | InChI=1S/C14H17ClN4O/c15-4-7-18-5-1-6-19(9-8-18)14(20)13-3-2-12(10-16)11-17-13/h2-3,11H,1,4-9H2 |
| InChIKey | YRZOMTNLPGKTHT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|