C15H23FN4O — CID 104637931
[4-(4-aminobutyl)-1,4-diazepan-1-yl]-(5-fluoro-2-pyridinyl)methanone (PubChem CID 104637931) has the molecular formula C15H23FN4O and a molecular weight of 294.37 g/mol. Its IUPAC name is [4-(4-aminobutyl)-1,4-diazepan-1-yl]-(5-fluoro-2-pyridinyl)methanone.
| Compound Name | [4-(4-aminobutyl)-1,4-diazepan-1-yl]-(5-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 104637931 |
| Molecular Formula | C15H23FN4O |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | [4-(4-aminobutyl)-1,4-diazepan-1-yl]-(5-fluoro-2-pyridinyl)methanone |
| SMILES | NCCCCN1CCCN(C(=O)c2ccc(F)cn2)CC1 |
| InChI | InChI=1S/C15H23FN4O/c16-13-4-5-14(18-12-13)15(21)20-9-3-8-19(10-11-20)7-2-1-6-17/h4-5,12H,1-3,6-11,17H2 |
| InChIKey | VDMSFJHFQCRHDA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|