C15H21F2N3O — CID 43251809
[4-(4-aminobutyl)piperazin-1-yl]-(3,5-difluorophenyl)methanone (PubChem CID 43251809) has the molecular formula C15H21F2N3O and a molecular weight of 297.35 g/mol. Its IUPAC name is [4-(4-aminobutyl)piperazin-1-yl]-(3,5-difluorophenyl)methanone.
| Compound Name | [4-(4-aminobutyl)piperazin-1-yl]-(3,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 43251809 |
| Molecular Formula | C15H21F2N3O |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [4-(4-aminobutyl)piperazin-1-yl]-(3,5-difluorophenyl)methanone |
| SMILES | NCCCCN1CCN(C(=O)c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C15H21F2N3O/c16-13-9-12(10-14(17)11-13)15(21)20-7-5-19(6-8-20)4-2-1-3-18/h9-11H,1-8,18H2 |
| InChIKey | DJPLBRHFGCAVOW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|