C13H18F2N4O2 — CID 63185912
(3,5-difluoro-4-hydrazinylphenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone (PubChem CID 63185912) has the molecular formula C13H18F2N4O2 and a molecular weight of 300.31 g/mol. Its IUPAC name is (3,5-difluoro-4-hydrazinylphenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone.
| Compound Name | (3,5-difluoro-4-hydrazinylphenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 63185912 |
| Molecular Formula | C13H18F2N4O2 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (3,5-difluoro-4-hydrazinylphenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
| SMILES | NNc1c(F)cc(C(=O)N2CCN(CCO)CC2)cc1F |
| InChI | InChI=1S/C13H18F2N4O2/c14-10-7-9(8-11(15)12(10)17-16)13(21)19-3-1-18(2-4-19)5-6-20/h7-8,17,20H,1-6,16H2 |
| InChIKey | KGHIOGIHSIMYIT-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|