C14H19Cl2N3O2 — CID 107218154
(4-amino-3,5-dichlorophenyl)-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methanone (PubChem CID 107218154) has the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.23 g/mol. Its IUPAC name is (4-amino-3,5-dichlorophenyl)-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (4-amino-3,5-dichlorophenyl)-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 107218154 |
| Molecular Formula | C14H19Cl2N3O2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (4-amino-3,5-dichlorophenyl)-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methanone |
| SMILES | Nc1c(Cl)cc(C(=O)N2CCCN(CCO)CC2)cc1Cl |
| InChI | InChI=1S/C14H19Cl2N3O2/c15-11-8-10(9-12(16)13(11)17)14(21)19-3-1-2-18(4-5-19)6-7-20/h8-9,20H,1-7,17H2 |
| InChIKey | RJYKZXLNFJYBEB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|