C14H17Cl2IN2O2 — CID 63308214
(3,5-dichloro-2-iodophenyl)-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methanone (PubChem CID 63308214) has the molecular formula C14H17Cl2IN2O2 and a molecular weight of 443.11 g/mol. Its IUPAC name is (3,5-dichloro-2-iodophenyl)-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (3,5-dichloro-2-iodophenyl)-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 63308214 |
| Molecular Formula | C14H17Cl2IN2O2 |
| Molecular Weight | 443.11 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | (3,5-dichloro-2-iodophenyl)-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1I)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C14H17Cl2IN2O2/c15-10-8-11(13(17)12(16)9-10)14(21)19-3-1-2-18(4-5-19)6-7-20/h8-9,20H,1-7H2 |
| InChIKey | HAJMMBWBWPBSNJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.11 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|