C13H15Cl2IN2O2 — CID 43391607
(3,5-dichloro-2-iodophenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone (PubChem CID 43391607) has the molecular formula C13H15Cl2IN2O2 and a molecular weight of 429.09 g/mol. Its IUPAC name is (3,5-dichloro-2-iodophenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone.
| Compound Name | (3,5-dichloro-2-iodophenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 43391607 |
| Molecular Formula | C13H15Cl2IN2O2 |
| Molecular Weight | 429.09 g/mol |
| Exact Mass | 427.96 |
| IUPAC Name | (3,5-dichloro-2-iodophenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1I)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C13H15Cl2IN2O2/c14-9-7-10(12(16)11(15)8-9)13(20)18-3-1-17(2-4-18)5-6-19/h7-8,19H,1-6H2 |
| InChIKey | GROVNMAKHYIGEC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.09 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|