C12H10Cl2INO3 — CID 64604803
2-[1-(3,5-dichloro-2-iodobenzoyl)azetidin-3-yl]acetic acid (PubChem CID 64604803) has the molecular formula C12H10Cl2INO3 and a molecular weight of 414.03 g/mol. Its IUPAC name is 2-[1-(3,5-dichloro-2-iodobenzoyl)azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-(3,5-dichloro-2-iodobenzoyl)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 64604803 |
| Molecular Formula | C12H10Cl2INO3 |
| Molecular Weight | 414.03 g/mol |
| Exact Mass | 412.91 |
| IUPAC Name | 2-[1-(3,5-dichloro-2-iodobenzoyl)azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)c2cc(Cl)cc(Cl)c2I)C1 |
| InChI | InChI=1S/C12H10Cl2INO3/c13-7-2-8(11(15)9(14)3-7)12(19)16-4-6(5-16)1-10(17)18/h2-3,6H,1,4-5H2,(H,17,18) |
| InChIKey | WKRPKFNKAXCONM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.03 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|