C14H14Cl2INO3 — CID 78919362
methyl (3S)-1-(3,5-dichloro-2-iodobenzoyl)piperidine-3-carboxylate (PubChem CID 78919362) has the molecular formula C14H14Cl2INO3 and a molecular weight of 442.08 g/mol. Its IUPAC name is methyl (3S)-1-(3,5-dichloro-2-iodobenzoyl)piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-(3,5-dichloro-2-iodobenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78919362 |
| Molecular Formula | C14H14Cl2INO3 |
| Molecular Weight | 442.08 g/mol |
| Exact Mass | 440.94 |
| IUPAC Name | methyl (3S)-1-(3,5-dichloro-2-iodobenzoyl)piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(C(=O)c2cc(Cl)cc(Cl)c2I)C1 |
| InChI | InChI=1S/C14H14Cl2INO3/c1-21-14(20)8-3-2-4-18(7-8)13(19)10-5-9(15)6-11(16)12(10)17/h5-6,8H,2-4,7H2,1H3/t8-/m0/s1 |
| InChIKey | RUKRMCLWLMNUKN-QMMMGPOBSA-N |
| XLogP | 3.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.08 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|