C13H12Cl2INO3 — CID 63146347
1-(3,5-dichloro-2-iodobenzoyl)-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 63146347) has the molecular formula C13H12Cl2INO3 and a molecular weight of 428.05 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-iodobenzoyl)-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3,5-dichloro-2-iodobenzoyl)-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63146347 |
| Molecular Formula | C13H12Cl2INO3 |
| Molecular Weight | 428.05 g/mol |
| Exact Mass | 426.92 |
| IUPAC Name | 1-(3,5-dichloro-2-iodobenzoyl)-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)c2cc(Cl)cc(Cl)c2I)C1 |
| InChI | InChI=1S/C13H12Cl2INO3/c1-13(12(19)20)2-3-17(6-13)11(18)8-4-7(14)5-9(15)10(8)16/h4-5H,2-3,6H2,1H3,(H,19,20) |
| InChIKey | GYGNTIPSCOKTCP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.05 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|