C13H13ClINO3 — CID 113263393
1-(5-chloro-2-iodobenzoyl)-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 113263393) has the molecular formula C13H13ClINO3 and a molecular weight of 393.61 g/mol. Its IUPAC name is 1-(5-chloro-2-iodobenzoyl)-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(5-chloro-2-iodobenzoyl)-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 113263393 |
| Molecular Formula | C13H13ClINO3 |
| Molecular Weight | 393.61 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | 1-(5-chloro-2-iodobenzoyl)-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)c2cc(Cl)ccc2I)C1 |
| InChI | InChI=1S/C13H13ClINO3/c1-13(12(18)19)4-5-16(7-13)11(17)9-6-8(14)2-3-10(9)15/h2-3,6H,4-5,7H2,1H3,(H,18,19) |
| InChIKey | YWLXSGVAMNTOKX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|