About 1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid
1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 120529226) has the molecular formula C19H25ClN2O4
and a molecular weight of 380.87 g/mol. Its IUPAC name is 1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid |
| PubChem CID | 120529226 |
| Molecular Formula | C19H25ClN2O4 |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC(C)(C)CC(=O)Nc1ccc(Cl)c(C(=O)N2CCC(C)(C(=O)O)C2)c1 |
| InChI | InChI=1S/C19H25ClN2O4/c1-18(2,3)10-15(23)21-12-5-6-14(20)13(9-12)16(24)22-8-7-19(4,11-22)17(25)26/h5-6,9H,7-8,10-11H2,1-4H3,(H,21,23)(H,25,26) |
| InChIKey | LLJKIVDXBSYUSK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid?
The IUPAC name of 1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid (CID 120529226) is 1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid is CC(C)(C)CC(=O)Nc1ccc(Cl)c(C(=O)N2CCC(C)(C(=O)O)C2)c1.
What is the InChIKey of 1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid?
The InChIKey is LLJKIVDXBSYUSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25ClN2O4/c1-18(2,3)10-15(23)21-12-5-6-14(20)13(9-12)16(24)22-8-7-19(4,11-22)17(25)26/h5-6,9H,7-8,10-11H2,1-4H3,(H,21,23)(H,25,26).
What are the key properties of 1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid?
1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid has a molecular weight of 380.87 g/mol, XLogP of 3.65, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]-3-methylpyrrolidine-3-carboxylic acid is sourced from PubChem (CID 120529226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).