C14H16ClNO4 — CID 106500274
1-(2-chloro-5-hydroxybenzoyl)-4-methylpiperidine-4-carboxylic acid (PubChem CID 106500274) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is 1-(2-chloro-5-hydroxybenzoyl)-4-methylpiperidine-4-carboxylic acid.
| Compound Name | 1-(2-chloro-5-hydroxybenzoyl)-4-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106500274 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-(2-chloro-5-hydroxybenzoyl)-4-methylpiperidine-4-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)c2cc(O)ccc2Cl)CC1 |
| InChI | InChI=1S/C14H16ClNO4/c1-14(13(19)20)4-6-16(7-5-14)12(18)10-8-9(17)2-3-11(10)15/h2-3,8,17H,4-7H2,1H3,(H,19,20) |
| InChIKey | JVFLMXMEAKXPPU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |