C14H17NO5 — CID 107702562
1-(3,5-dihydroxybenzoyl)-4-methylpiperidine-4-carboxylic acid (PubChem CID 107702562) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-(3,5-dihydroxybenzoyl)-4-methylpiperidine-4-carboxylic acid.
| Compound Name | 1-(3,5-dihydroxybenzoyl)-4-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107702562 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-(3,5-dihydroxybenzoyl)-4-methylpiperidine-4-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)c2cc(O)cc(O)c2)CC1 |
| InChI | InChI=1S/C14H17NO5/c1-14(13(19)20)2-4-15(5-3-14)12(18)9-6-10(16)8-11(17)7-9/h6-8,16-17H,2-5H2,1H3,(H,19,20) |
| InChIKey | CETZPNFZTRBSAJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |