C14H19NO5 — CID 84582248
(3,5-dihydroxyphenyl)-(4,4-dimethoxypiperidin-1-yl)methanone (PubChem CID 84582248) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is (3,5-dihydroxyphenyl)-(4,4-dimethoxypiperidin-1-yl)methanone.
| Compound Name | (3,5-dihydroxyphenyl)-(4,4-dimethoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 84582248 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (3,5-dihydroxyphenyl)-(4,4-dimethoxypiperidin-1-yl)methanone |
| SMILES | COC1(OC)CCN(C(=O)c2cc(O)cc(O)c2)CC1 |
| InChI | InChI=1S/C14H19NO5/c1-19-14(20-2)3-5-15(6-4-14)13(18)10-7-11(16)9-12(17)8-10/h7-9,16-17H,3-6H2,1-2H3 |
| InChIKey | NIBWCKXNFBKIEO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|