C13H17NO5 — CID 103579430
(3,5-dihydroxyphenyl)-(3,4-dimethoxypyrrolidin-1-yl)methanone (PubChem CID 103579430) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is (3,5-dihydroxyphenyl)-(3,4-dimethoxypyrrolidin-1-yl)methanone.
| Compound Name | (3,5-dihydroxyphenyl)-(3,4-dimethoxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 103579430 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (3,5-dihydroxyphenyl)-(3,4-dimethoxypyrrolidin-1-yl)methanone |
| SMILES | COC1CN(C(=O)c2cc(O)cc(O)c2)CC1OC |
| InChI | InChI=1S/C13H17NO5/c1-18-11-6-14(7-12(11)19-2)13(17)8-3-9(15)5-10(16)4-8/h3-5,11-12,15-16H,6-7H2,1-2H3 |
| InChIKey | XDYKDCTXIGHHRE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |