About methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride
methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride (PubChem CID 154910922) has the molecular formula C16H21ClN2O4
and a molecular weight of 340.81 g/mol. Its IUPAC name is methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride |
| PubChem CID | 154910922 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride |
| SMILES | COC(=O)c1cc(O)cc(C(=O)N2C[C@H]3CC[C@@H](C2)C3N)c1.Cl |
| InChI | InChI=1S/C16H20N2O4.ClH/c1-22-16(21)12-4-11(5-13(19)6-12)15(20)18-7-9-2-3-10(8-18)14(9)17;/h4-6,9-10,14,19H,2-3,7-8,17H2,1H3;1H/t9-,10+,14?; |
| InChIKey | ZJTJBDMGDXCJHC-ZXBMJCERSA-N |
| XLogP | 1.41 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride?
The IUPAC name of methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride (CID 154910922) is methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride.
What is the SMILES notation for methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride?
The canonical SMILES for methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride is COC(=O)c1cc(O)cc(C(=O)N2C[C@H]3CC[C@@H](C2)C3N)c1.Cl.
What is the InChIKey of methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride?
The InChIKey is ZJTJBDMGDXCJHC-ZXBMJCERSA-N. The full InChI is InChI=1S/C16H20N2O4.ClH/c1-22-16(21)12-4-11(5-13(19)6-12)15(20)18-7-9-2-3-10(8-18)14(9)17;/h4-6,9-10,14,19H,2-3,7-8,17H2,1H3;1H/t9-,10+,14?;.
What are the key properties of methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride?
methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride has a molecular weight of 340.81 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octane-3-carbonyl]-5-hydroxybenzoate;hydrochloride is sourced from PubChem (CID 154910922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).