C12H15BrO5 — CID 175420883
bromoethane;dimethyl 5-hydroxybenzene-1,3-dicarboxylate (PubChem CID 175420883) has the molecular formula C12H15BrO5 and a molecular weight of 319.15 g/mol. Its IUPAC name is bromoethane;dimethyl 5-hydroxybenzene-1,3-dicarboxylate.
| Compound Name | bromoethane;dimethyl 5-hydroxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 175420883 |
| Molecular Formula | C12H15BrO5 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | bromoethane;dimethyl 5-hydroxybenzene-1,3-dicarboxylate |
| SMILES | CCBr.COC(=O)c1cc(O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C10H10O5.C2H5Br/c1-14-9(12)6-3-7(10(13)15-2)5-8(11)4-6;1-2-3/h3-5,11H,1-2H3;2H2,1H3 |
| InChIKey | KDJKDUKERFMBNZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|