C11H12BrNO6S — CID 83084846
dimethyl 5-(bromomethylsulfonylamino)benzene-1,3-dicarboxylate (PubChem CID 83084846) has the molecular formula C11H12BrNO6S and a molecular weight of 366.19 g/mol. Its IUPAC name is dimethyl 5-(bromomethylsulfonylamino)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(bromomethylsulfonylamino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 83084846 |
| Molecular Formula | C11H12BrNO6S |
| Molecular Weight | 366.19 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | dimethyl 5-(bromomethylsulfonylamino)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)CBr)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C11H12BrNO6S/c1-18-10(14)7-3-8(11(15)19-2)5-9(4-7)13-20(16,17)6-12/h3-5,13H,6H2,1-2H3 |
| InChIKey | MGEMGLXXLNYZBB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|