C10H10NNaO7S — CID 23674132
sodium N-[3,5-bis(methoxycarbonyl)phenyl]sulfamate (PubChem CID 23674132) has the molecular formula C10H10NNaO7S and a molecular weight of 311.25 g/mol. Its IUPAC name is sodium N-[3,5-bis(methoxycarbonyl)phenyl]sulfamate.
| Compound Name | sodium N-[3,5-bis(methoxycarbonyl)phenyl]sulfamate |
|---|---|
| PubChem CID | 23674132 |
| Molecular Formula | C10H10NNaO7S |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | sodium N-[3,5-bis(methoxycarbonyl)phenyl]sulfamate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)[O-])cc(C(=O)OC)c1.[Na+] |
| InChI | InChI=1S/C10H11NO7S.Na/c1-17-9(12)6-3-7(10(13)18-2)5-8(4-6)11-19(14,15)16;/h3-5,11H,1-2H3,(H,14,15,16);/q;+1/p-1 |
| InChIKey | GGCYJGYHYGDNHR-UHFFFAOYSA-M |
| XLogP | -2.86 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|