C11H13NO5 — CID 58723142
dimethyl 5-(hydroxymethylamino)benzene-1,3-dicarboxylate (PubChem CID 58723142) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is dimethyl 5-(hydroxymethylamino)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(hydroxymethylamino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 58723142 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | dimethyl 5-(hydroxymethylamino)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NCO)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C11H13NO5/c1-16-10(14)7-3-8(11(15)17-2)5-9(4-7)12-6-13/h3-5,12-13H,6H2,1-2H3 |
| InChIKey | AGRFRNWACMABKA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|