C11H11ClO4 — CID 45108192
dimethyl 5-(chloromethyl)benzene-1,3-dicarboxylate (PubChem CID 45108192) has the molecular formula C11H11ClO4 and a molecular weight of 242.66 g/mol. Its IUPAC name is dimethyl 5-(chloromethyl)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(chloromethyl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 45108192 |
| Molecular Formula | C11H11ClO4 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | dimethyl 5-(chloromethyl)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(CCl)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C11H11ClO4/c1-15-10(13)8-3-7(6-12)4-9(5-8)11(14)16-2/h3-5H,6H2,1-2H3 |
| InChIKey | IYYKJOHNIKKVAI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|