C11H11BF3O4- — CID 171374200
[3,5-bis(methoxycarbonyl)phenyl]methyl-trifluoroboranuide (PubChem CID 171374200) has the molecular formula C11H11BF3O4- and a molecular weight of 275.01 g/mol. Its IUPAC name is [3,5-bis(methoxycarbonyl)phenyl]methyl-trifluoroboranuide.
| Compound Name | [3,5-bis(methoxycarbonyl)phenyl]methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 171374200 |
| Molecular Formula | C11H11BF3O4- |
| Molecular Weight | 275.01 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | [3,5-bis(methoxycarbonyl)phenyl]methyl-trifluoroboranuide |
| SMILES | COC(=O)c1cc(C[B-](F)(F)F)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C11H11BF3O4/c1-18-10(16)8-3-7(6-12(13,14)15)4-9(5-8)11(17)19-2/h3-5H,6H2,1-2H3/q-1 |
| InChIKey | WFJRUFFRTKZSLY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.01 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|