C32H30N2O8+2 — CID 71507656
dimethyl 5-[[4-[1-[[3,5-bis(methoxycarbonyl)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzene-1,3-dicarboxylate (PubChem CID 71507656) has the molecular formula C32H30N2O8+2 and a molecular weight of 570.60 g/mol. Its IUPAC name is dimethyl 5-[[4-[1-[[3,5-bis(methoxycarbonyl)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[4-[1-[[3,5-bis(methoxycarbonyl)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71507656 |
| Molecular Formula | C32H30N2O8+2 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | dimethyl 5-[[4-[1-[[3,5-bis(methoxycarbonyl)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C[n+]2ccc(-c3cc[n+](Cc4cc(C(=O)OC)cc(C(=O)OC)c4)cc3)cc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C32H30N2O8/c1-39-29(35)25-13-21(14-26(17-25)30(36)40-2)19-33-9-5-23(6-10-33)24-7-11-34(12-8-24)20-22-15-27(31(37)41-3)18-28(16-22)32(38)42-4/h5-18H,19-20H2,1-4H3/q+2 |
| InChIKey | OAWBYEQLZXYXEU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 112.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|