C40H33N2O5P+2 — CID 153305247
methyl 4-[[4-[2-[[4-(formyloxymethyl)phenyl]methyl]-9-oxo-9-phenylphosphindolo[2,3-c]pyridin-2-ium-7-yl]pyridin-1-ium-1-yl]methyl]benzoate (PubChem CID 153305247) has the molecular formula C40H33N2O5P+2 and a molecular weight of 652.69 g/mol. Its IUPAC name is methyl 4-[[4-[2-[[4-(formyloxymethyl)phenyl]methyl]-9-oxo-9-phenylphosphindolo[2,3-c]pyridin-2-ium-7-yl]pyridin-1-ium-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-[2-[[4-(formyloxymethyl)phenyl]methyl]-9-oxo-9-phenylphosphindolo[2,3-c]pyridin-2-ium-7-yl]pyridin-1-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 153305247 |
| Molecular Formula | C40H33N2O5P+2 |
| Molecular Weight | 652.69 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | methyl 4-[[4-[2-[[4-(formyloxymethyl)phenyl]methyl]-9-oxo-9-phenylphosphindolo[2,3-c]pyridin-2-ium-7-yl]pyridin-1-ium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C[n+]2ccc(-c3ccc4c(c3)P(=O)(c3ccccc3)c3c[n+](Cc5ccc(COC=O)cc5)ccc3-4)cc2)cc1 |
| InChI | InChI=1S/C40H33N2O5P/c1-46-40(44)33-13-11-30(12-14-33)24-41-20-17-32(18-21-41)34-15-16-36-37-19-22-42(25-29-7-9-31(10-8-29)27-47-28-43)26-39(37)48(45,38(36)23-34)35-5-3-2-4-6-35/h2-23,26,28H,24-25,27H2,1H3/q+2 |
| InChIKey | LOYNBZVZZUYURK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.69 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|