C28H22F6N2O2+2 — CID 129068578
methyl 3-[[4-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzoate (PubChem CID 129068578) has the molecular formula C28H22F6N2O2+2 and a molecular weight of 532.48 g/mol. Its IUPAC name is methyl 3-[[4-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[4-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 129068578 |
| Molecular Formula | C28H22F6N2O2+2 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | methyl 3-[[4-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(C[n+]2ccc(-c3cc[n+](Cc4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C28H22F6N2O2/c1-38-26(37)23-4-2-3-19(13-23)17-35-9-5-21(6-10-35)22-7-11-36(12-8-22)18-20-14-24(27(29,30)31)16-25(15-20)28(32,33)34/h2-16H,17-18H2,1H3/q+2 |
| InChIKey | FHHXTVUHLLQONZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|