C22H17BrF6N2O — CID 11678014
N-[(1-benzylpyridin-1-ium-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide bromide (PubChem CID 11678014) has the molecular formula C22H17BrF6N2O and a molecular weight of 519.28 g/mol. Its IUPAC name is N-[(1-benzylpyridin-1-ium-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide bromide.
| Compound Name | N-[(1-benzylpyridin-1-ium-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide bromide |
|---|---|
| PubChem CID | 11678014 |
| Molecular Formula | C22H17BrF6N2O |
| Molecular Weight | 519.28 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | N-[(1-benzylpyridin-1-ium-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide bromide |
| SMILES | O=C(NCc1cc[n+](Cc2ccccc2)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[Br-] |
| InChI | InChI=1S/C22H16F6N2O.BrH/c23-21(24,25)18-10-17(11-19(12-18)22(26,27)28)20(31)29-13-15-6-8-30(9-7-15)14-16-4-2-1-3-5-16;/h1-12H,13-14H2;1H |
| InChIKey | IEVJRVZEYGDFCG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|