C18H13F6N2+ — CID 163299593
1-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-ium (PubChem CID 163299593) has the molecular formula C18H13F6N2+ and a molecular weight of 371.30 g/mol. Its IUPAC name is 1-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-ium.
| Compound Name | 1-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-ium |
|---|---|
| PubChem CID | 163299593 |
| Molecular Formula | C18H13F6N2+ |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 1-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-ium |
| SMILES | FC(F)(F)c1cc(-n2cc[n+](Cc3ccccc3)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13F6N2/c19-17(20,21)14-8-15(18(22,23)24)10-16(9-14)26-7-6-25(12-26)11-13-4-2-1-3-5-13/h1-10,12H,11H2/q+1 |
| InChIKey | WVFCWIKWSJGKQB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|