C22H19F3N3O2+ — CID 10767493
methyl 3-[[3-(2-cyanoethyl)-5-[4-(trifluoromethyl)phenyl]imidazol-3-ium-1-yl]methyl]benzoate (PubChem CID 10767493) has the molecular formula C22H19F3N3O2+ and a molecular weight of 414.41 g/mol. Its IUPAC name is methyl 3-[[3-(2-cyanoethyl)-5-[4-(trifluoromethyl)phenyl]imidazol-3-ium-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[3-(2-cyanoethyl)-5-[4-(trifluoromethyl)phenyl]imidazol-3-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 10767493 |
| Molecular Formula | C22H19F3N3O2+ |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | methyl 3-[[3-(2-cyanoethyl)-5-[4-(trifluoromethyl)phenyl]imidazol-3-ium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(Cn2c[n+](CCC#N)cc2-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C22H19F3N3O2/c1-30-21(29)18-5-2-4-16(12-18)13-28-15-27(11-3-10-26)14-20(28)17-6-8-19(9-7-17)22(23,24)25/h2,4-9,12,14-15H,3,11,13H2,1H3/q+1 |
| InChIKey | BZIRQSDHYMMQHY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|