C31H22F3NO3 — CID 75601743
methyl 3-[[2-oxo-3-[phenyl-[4-(trifluoromethyl)phenyl]methylidene]indol-1-yl]methyl]benzoate (PubChem CID 75601743) has the molecular formula C31H22F3NO3 and a molecular weight of 513.52 g/mol. Its IUPAC name is methyl 3-[[2-oxo-3-[phenyl-[4-(trifluoromethyl)phenyl]methylidene]indol-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[2-oxo-3-[phenyl-[4-(trifluoromethyl)phenyl]methylidene]indol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 75601743 |
| Molecular Formula | C31H22F3NO3 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | methyl 3-[[2-oxo-3-[phenyl-[4-(trifluoromethyl)phenyl]methylidene]indol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CN2C(=O)C(=C(c3ccccc3)c3ccc(C(F)(F)F)cc3)c3ccccc32)c1 |
| InChI | InChI=1S/C31H22F3NO3/c1-38-30(37)23-11-7-8-20(18-23)19-35-26-13-6-5-12-25(26)28(29(35)36)27(21-9-3-2-4-10-21)22-14-16-24(17-15-22)31(32,33)34/h2-18H,19H2,1H3 |
| InChIKey | XPTPUMBILUOBND-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|