C30H20F3NO4 — CID 51035101
3-[[(3E)-2-oxo-3-[phenyl-[2-(trifluoromethoxy)phenyl]methylidene]indol-1-yl]methyl]benzoic acid (PubChem CID 51035101) has the molecular formula C30H20F3NO4 and a molecular weight of 515.49 g/mol. Its IUPAC name is 3-[[(3E)-2-oxo-3-[phenyl-[2-(trifluoromethoxy)phenyl]methylidene]indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[(3E)-2-oxo-3-[phenyl-[2-(trifluoromethoxy)phenyl]methylidene]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 51035101 |
| Molecular Formula | C30H20F3NO4 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 3-[[(3E)-2-oxo-3-[phenyl-[2-(trifluoromethoxy)phenyl]methylidene]indol-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2C(=O)/C(=C(\c3ccccc3)c3ccccc3OC(F)(F)F)c3ccccc32)c1 |
| InChI | InChI=1S/C30H20F3NO4/c31-30(32,33)38-25-16-7-5-14-23(25)26(20-10-2-1-3-11-20)27-22-13-4-6-15-24(22)34(28(27)35)18-19-9-8-12-21(17-19)29(36)37/h1-17H,18H2,(H,36,37)/b27-26+ |
| InChIKey | ICINAXKSSWVRFJ-CYYJNZCTSA-N |
| XLogP | 6.79 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|