C28H20ClNO4 — CID 51033994
(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-1-[(3,4,5-trihydroxyphenyl)methyl]indol-2-one (PubChem CID 51033994) has the molecular formula C28H20ClNO4 and a molecular weight of 469.92 g/mol. Its IUPAC name is (3E)-3-[(4-chlorophenyl)-phenylmethylidene]-1-[(3,4,5-trihydroxyphenyl)methyl]indol-2-one.
| Compound Name | (3E)-3-[(4-chlorophenyl)-phenylmethylidene]-1-[(3,4,5-trihydroxyphenyl)methyl]indol-2-one |
|---|---|
| PubChem CID | 51033994 |
| Molecular Formula | C28H20ClNO4 |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | (3E)-3-[(4-chlorophenyl)-phenylmethylidene]-1-[(3,4,5-trihydroxyphenyl)methyl]indol-2-one |
| SMILES | O=C1/C(=C(\c2ccccc2)c2ccc(Cl)cc2)c2ccccc2N1Cc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C28H20ClNO4/c29-20-12-10-19(11-13-20)25(18-6-2-1-3-7-18)26-21-8-4-5-9-22(21)30(28(26)34)16-17-14-23(31)27(33)24(32)15-17/h1-15,31-33H,16H2/b26-25+ |
| InChIKey | JWNVOJMJLBFMIO-OCEACIFDSA-N |
| XLogP | 5.96 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|