C29H19ClFNO3 — CID 51034207
3-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-6-fluoro-2-oxoindol-1-yl]methyl]benzoic acid (PubChem CID 51034207) has the molecular formula C29H19ClFNO3 and a molecular weight of 483.93 g/mol. Its IUPAC name is 3-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-6-fluoro-2-oxoindol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-6-fluoro-2-oxoindol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 51034207 |
| Molecular Formula | C29H19ClFNO3 |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 3-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-6-fluoro-2-oxoindol-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2C(=O)/C(=C(\c3ccccc3)c3ccc(Cl)cc3)c3ccc(F)cc32)c1 |
| InChI | InChI=1S/C29H19ClFNO3/c30-22-11-9-20(10-12-22)26(19-6-2-1-3-7-19)27-24-14-13-23(31)16-25(24)32(28(27)33)17-18-5-4-8-21(15-18)29(34)35/h1-16H,17H2,(H,34,35)/b27-26+ |
| InChIKey | WMWIENICARWCGM-CYYJNZCTSA-N |
| XLogP | 6.68 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|