C31H19F6NO3 — CID 51034211
3-[[(3E)-3-[[3,5-bis(trifluoromethyl)phenyl]-phenylmethylidene]-2-oxoindol-1-yl]methyl]benzoic acid (PubChem CID 51034211) has the molecular formula C31H19F6NO3 and a molecular weight of 567.49 g/mol. Its IUPAC name is 3-[[(3E)-3-[[3,5-bis(trifluoromethyl)phenyl]-phenylmethylidene]-2-oxoindol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[(3E)-3-[[3,5-bis(trifluoromethyl)phenyl]-phenylmethylidene]-2-oxoindol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 51034211 |
| Molecular Formula | C31H19F6NO3 |
| Molecular Weight | 567.49 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | 3-[[(3E)-3-[[3,5-bis(trifluoromethyl)phenyl]-phenylmethylidene]-2-oxoindol-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2C(=O)/C(=C(\c3ccccc3)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C31H19F6NO3/c32-30(33,34)22-14-21(15-23(16-22)31(35,36)37)26(19-8-2-1-3-9-19)27-24-11-4-5-12-25(24)38(28(27)39)17-18-7-6-10-20(13-18)29(40)41/h1-16H,17H2,(H,40,41)/b27-26+ |
| InChIKey | WDGVXLZMYITOAH-CYYJNZCTSA-N |
| XLogP | 7.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.49 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|