C29H23NO2 — CID 101359125
(3Z)-1-benzyl-3-[(4-methoxyphenyl)-phenylmethylidene]indol-2-one (PubChem CID 101359125) has the molecular formula C29H23NO2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (3Z)-1-benzyl-3-[(4-methoxyphenyl)-phenylmethylidene]indol-2-one.
| Compound Name | (3Z)-1-benzyl-3-[(4-methoxyphenyl)-phenylmethylidene]indol-2-one |
|---|---|
| PubChem CID | 101359125 |
| Molecular Formula | C29H23NO2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (3Z)-1-benzyl-3-[(4-methoxyphenyl)-phenylmethylidene]indol-2-one |
| SMILES | COc1ccc(/C(=C2\C(=O)N(Cc3ccccc3)c3ccccc32)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H23NO2/c1-32-24-18-16-23(17-19-24)27(22-12-6-3-7-13-22)28-25-14-8-9-15-26(25)30(29(28)31)20-21-10-4-2-5-11-21/h2-19H,20H2,1H3/b28-27- |
| InChIKey | BMQJKMSPRMWOPA-DQSJHHFOSA-N |
| XLogP | 6.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|