C31H27NO4 — CID 98161431
(1S,2R,6R,7S)-4-benzyl-10-[bis(4-methoxyphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98161431) has the molecular formula C31H27NO4 and a molecular weight of 477.56 g/mol. Its IUPAC name is (1S,2R,6R,7S)-4-benzyl-10-[bis(4-methoxyphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S)-4-benzyl-10-[bis(4-methoxyphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98161431 |
| Molecular Formula | C31H27NO4 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | (1S,2R,6R,7S)-4-benzyl-10-[bis(4-methoxyphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COc1ccc(C(=C2[C@H]3C=C[C@H]2[C@H]2C(=O)N(Cc4ccccc4)C(=O)[C@@H]23)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H27NO4/c1-35-22-12-8-20(9-13-22)26(21-10-14-23(36-2)15-11-21)27-24-16-17-25(27)29-28(24)30(33)32(31(29)34)18-19-6-4-3-5-7-19/h3-17,24-25,28-29H,18H2,1-2H3/t24-,25-,28-,29-/m1/s1 |
| InChIKey | JALGVJJBNPXALR-WPUBFDFZSA-N |
| XLogP | 5.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|