C24H21NO4 — CID 124763410
(1S,2S,6S,7S)-10-[bis(4-methoxyphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 124763410) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is (1S,2S,6S,7S)-10-[bis(4-methoxyphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2S,6S,7S)-10-[bis(4-methoxyphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 124763410 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (1S,2S,6S,7S)-10-[bis(4-methoxyphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COc1ccc(C(=C2[C@H]3C=C[C@H]2[C@@H]2C(=O)NC(=O)[C@H]23)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H21NO4/c1-28-15-7-3-13(4-8-15)19(14-5-9-16(29-2)10-6-14)20-17-11-12-18(20)22-21(17)23(26)25-24(22)27/h3-12,17-18,21-22H,1-2H3,(H,25,26,27)/t17-,18-,21+,22+/m1/s1 |
| InChIKey | KRJFYKKPENKMNE-UBBRYJJRSA-N |
| XLogP | 3.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|