C17H18N2O4 — CID 132961847
(3aS,4S,8aR,8bR)-4-(4-methoxybenzoyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 132961847) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is (3aS,4S,8aR,8bR)-4-(4-methoxybenzoyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | (3aS,4S,8aR,8bR)-4-(4-methoxybenzoyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 132961847 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (3aS,4S,8aR,8bR)-4-(4-methoxybenzoyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | COc1ccc(C(=O)[C@@H]2[C@H]3C(=O)NC(=O)[C@H]3[C@H]3CCCN32)cc1 |
| InChI | InChI=1S/C17H18N2O4/c1-23-10-6-4-9(5-7-10)15(20)14-13-12(16(21)18-17(13)22)11-3-2-8-19(11)14/h4-7,11-14H,2-3,8H2,1H3,(H,18,21,22)/t11-,12+,13+,14+/m1/s1 |
| InChIKey | YUCSDEBOHLXWPO-RFGFWPKPSA-N |
| XLogP | 0.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|