C23H20ClFN2O4 — CID 98196250
(3aR,4S,8aR,8bS)-2-(5-chloro-2-methoxyphenyl)-4-(4-fluorobenzoyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 98196250) has the molecular formula C23H20ClFN2O4 and a molecular weight of 442.87 g/mol. Its IUPAC name is (3aR,4S,8aR,8bS)-2-(5-chloro-2-methoxyphenyl)-4-(4-fluorobenzoyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | (3aR,4S,8aR,8bS)-2-(5-chloro-2-methoxyphenyl)-4-(4-fluorobenzoyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 98196250 |
| Molecular Formula | C23H20ClFN2O4 |
| Molecular Weight | 442.87 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | (3aR,4S,8aR,8bS)-2-(5-chloro-2-methoxyphenyl)-4-(4-fluorobenzoyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | COc1ccc(Cl)cc1N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1CCCN1[C@@H]2C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H20ClFN2O4/c1-31-17-9-6-13(24)11-16(17)27-22(29)18-15-3-2-10-26(15)20(19(18)23(27)30)21(28)12-4-7-14(25)8-5-12/h4-9,11,15,18-20H,2-3,10H2,1H3/t15-,18-,19-,20+/m1/s1 |
| InChIKey | HTVROKSUZNDXQZ-XLNTUCKNSA-N |
| XLogP | 3.32 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.87 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|