C23H20ClN3O6 — CID 99983154
(3aS,4S,8aR,8bR)-4-(4-chlorobenzoyl)-2-(2-methoxy-4-nitrophenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 99983154) has the molecular formula C23H20ClN3O6 and a molecular weight of 469.88 g/mol. Its IUPAC name is (3aS,4S,8aR,8bR)-4-(4-chlorobenzoyl)-2-(2-methoxy-4-nitrophenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | (3aS,4S,8aR,8bR)-4-(4-chlorobenzoyl)-2-(2-methoxy-4-nitrophenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 99983154 |
| Molecular Formula | C23H20ClN3O6 |
| Molecular Weight | 469.88 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | (3aS,4S,8aR,8bR)-4-(4-chlorobenzoyl)-2-(2-methoxy-4-nitrophenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | COc1cc([N+](=O)[O-])ccc1N1C(=O)[C@@H]2[C@H](C1=O)[C@@H](C(=O)c1ccc(Cl)cc1)N1CCC[C@H]21 |
| InChI | InChI=1S/C23H20ClN3O6/c1-33-17-11-14(27(31)32)8-9-15(17)26-22(29)18-16-3-2-10-25(16)20(19(18)23(26)30)21(28)12-4-6-13(24)7-5-12/h4-9,11,16,18-20H,2-3,10H2,1H3/t16-,18+,19+,20+/m1/s1 |
| InChIKey | ZKVONUSPGCQWCG-GTAWCEEGSA-N |
| XLogP | 3.09 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.88 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|