C23H21N3O5 — CID 6354890
(3aR,4S,8aR,8bR)-4-benzoyl-2-(2-methyl-5-nitrophenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 6354890) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is (3aR,4S,8aR,8bR)-4-benzoyl-2-(2-methyl-5-nitrophenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | (3aR,4S,8aR,8bR)-4-benzoyl-2-(2-methyl-5-nitrophenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 6354890 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (3aR,4S,8aR,8bR)-4-benzoyl-2-(2-methyl-5-nitrophenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N1C(=O)[C@@H]2[C@@H](C1=O)[C@@H](C(=O)c1ccccc1)N1CCC[C@H]21 |
| InChI | InChI=1S/C23H21N3O5/c1-13-9-10-15(26(30)31)12-17(13)25-22(28)18-16-8-5-11-24(16)20(19(18)23(25)29)21(27)14-6-3-2-4-7-14/h2-4,6-7,9-10,12,16,18-20H,5,8,11H2,1H3/t16-,18+,19-,20+/m1/s1 |
| InChIKey | QWNBLHFUXGLTON-MDNKFWRPSA-N |
| XLogP | 2.74 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|