C23H21N3O6 — CID 4910194
4-benzoyl-2-(2-methoxy-4-nitrophenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 4910194) has the molecular formula C23H21N3O6 and a molecular weight of 435.44 g/mol. Its IUPAC name is 4-benzoyl-2-(2-methoxy-4-nitrophenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | 4-benzoyl-2-(2-methoxy-4-nitrophenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 4910194 |
| Molecular Formula | C23H21N3O6 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 4-benzoyl-2-(2-methoxy-4-nitrophenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | COc1cc([N+](=O)[O-])ccc1N1C(=O)C2C(C1=O)C(C(=O)c1ccccc1)N1CCCC21 |
| InChI | InChI=1S/C23H21N3O6/c1-32-17-12-14(26(30)31)9-10-15(17)25-22(28)18-16-8-5-11-24(16)20(19(18)23(25)29)21(27)13-6-3-2-4-7-13/h2-4,6-7,9-10,12,16,18-20H,5,8,11H2,1H3 |
| InChIKey | DTRCFYFVHKQYOT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|