C31H26ClNO5 — CID 21370458
10-[bis(4-methoxyphenyl)methylidene]-4-(5-chloro-2-methoxyphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 21370458) has the molecular formula C31H26ClNO5 and a molecular weight of 528.00 g/mol. Its IUPAC name is 10-[bis(4-methoxyphenyl)methylidene]-4-(5-chloro-2-methoxyphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 10-[bis(4-methoxyphenyl)methylidene]-4-(5-chloro-2-methoxyphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 21370458 |
| Molecular Formula | C31H26ClNO5 |
| Molecular Weight | 528.00 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 10-[bis(4-methoxyphenyl)methylidene]-4-(5-chloro-2-methoxyphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COc1ccc(C(=C2C3C=CC2C2C(=O)N(c4cc(Cl)ccc4OC)C(=O)C32)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H26ClNO5/c1-36-20-9-4-17(5-10-20)26(18-6-11-21(37-2)12-7-18)27-22-13-14-23(27)29-28(22)30(34)33(31(29)35)24-16-19(32)8-15-25(24)38-3/h4-16,22-23,28-29H,1-3H3 |
| InChIKey | LKXDIBABZXAUOQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.00 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|