C32H28ClNO3 — CID 123267133
3-[(4-chlorophenyl)-phenylmethylidene]-1-[[4-(2-ethoxyethoxy)phenyl]methyl]indol-2-one (PubChem CID 123267133) has the molecular formula C32H28ClNO3 and a molecular weight of 510.03 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)-phenylmethylidene]-1-[[4-(2-ethoxyethoxy)phenyl]methyl]indol-2-one.
| Compound Name | 3-[(4-chlorophenyl)-phenylmethylidene]-1-[[4-(2-ethoxyethoxy)phenyl]methyl]indol-2-one |
|---|---|
| PubChem CID | 123267133 |
| Molecular Formula | C32H28ClNO3 |
| Molecular Weight | 510.03 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 3-[(4-chlorophenyl)-phenylmethylidene]-1-[[4-(2-ethoxyethoxy)phenyl]methyl]indol-2-one |
| SMILES | CCOCCOc1ccc(CN2C(=O)C(=C(c3ccccc3)c3ccc(Cl)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C32H28ClNO3/c1-2-36-20-21-37-27-18-12-23(13-19-27)22-34-29-11-7-6-10-28(29)31(32(34)35)30(24-8-4-3-5-9-24)25-14-16-26(33)17-15-25/h3-19H,2,20-22H2,1H3 |
| InChIKey | GFOLGDKRPCHBRW-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.03 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|