C30H22ClNO3 — CID 67036239
methyl 2-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-2-oxoindol-1-yl]methyl]benzoate (PubChem CID 67036239) has the molecular formula C30H22ClNO3 and a molecular weight of 479.96 g/mol. Its IUPAC name is methyl 2-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-2-oxoindol-1-yl]methyl]benzoate.
| Compound Name | methyl 2-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-2-oxoindol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 67036239 |
| Molecular Formula | C30H22ClNO3 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | methyl 2-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-2-oxoindol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1CN1C(=O)/C(=C(\c2ccccc2)c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C30H22ClNO3/c1-35-30(34)24-12-6-5-11-22(24)19-32-26-14-8-7-13-25(26)28(29(32)33)27(20-9-3-2-4-10-20)21-15-17-23(31)18-16-21/h2-18H,19H2,1H3/b28-27+ |
| InChIKey | DTYSMNNCYATRDC-BYYHNAKLSA-N |
| XLogP | 6.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|