C16H11NO4 — CID 43415538
2-[(2,3-dioxoindol-1-yl)methyl]benzoic acid (PubChem CID 43415538) has the molecular formula C16H11NO4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-[(2,3-dioxoindol-1-yl)methyl]benzoic acid.
| Compound Name | 2-[(2,3-dioxoindol-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 43415538 |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-[(2,3-dioxoindol-1-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H11NO4/c18-14-12-7-3-4-8-13(12)17(15(14)19)9-10-5-1-2-6-11(10)16(20)21/h1-8H,9H2,(H,20,21) |
| InChIKey | XTVQTKPILILQDU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|